C22H28 — CID 158066102
4-methyltricyclo[5.2.1.02,6]deca-3,8-diene;8-methyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 158066102) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-methyltricyclo[5.2.1.02,6]deca-3,8-diene;8-methyltricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 4-methyltricyclo[5.2.1.02,6]deca-3,8-diene;8-methyltricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 158066102 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4-methyltricyclo[5.2.1.02,6]deca-3,8-diene;8-methyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CC1=CC2C3C=CC(C3)C2C1.CC1=CC2CC1C1CC=CC21 |
| InChI | InChI=1S/2C11H14/c1-7-4-10-8-2-3-9(6-8)11(10)5-7;1-7-5-8-6-11(7)10-4-2-3-9(8)10/h2-4,8-11H,5-6H2,1H3;2-3,5,8-11H,4,6H2,1H3 |
| InChIKey | FLFYZNINYPTWGE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|