About 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide
2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide (PubChem CID 68946058) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide |
| PubChem CID | 68946058 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide |
| SMILES | NC(=O)c1ccc(C2CC(=O)NC(=O)C2)cc1C1=CCCCC1 |
| InChI | InChI=1S/C18H20N2O3/c19-18(23)14-7-6-12(13-9-16(21)20-17(22)10-13)8-15(14)11-4-2-1-3-5-11/h4,6-8,13H,1-3,5,9-10H2,(H2,19,23)(H,20,21,22) |
| InChIKey | AWOBWOULMRJOLU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide?
The IUPAC name of 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide (CID 68946058) is 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide.
What is the SMILES notation for 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide?
The canonical SMILES for 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide is NC(=O)c1ccc(C2CC(=O)NC(=O)C2)cc1C1=CCCCC1.
What is the InChIKey of 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide?
The InChIKey is AWOBWOULMRJOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3/c19-18(23)14-7-6-12(13-9-16(21)20-17(22)10-13)8-15(14)11-4-2-1-3-5-11/h4,6-8,13H,1-3,5,9-10H2,(H2,19,23)(H,20,21,22).
What are the key properties of 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide?
2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide has a molecular weight of 312.37 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)benzamide is sourced from PubChem (CID 68946058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).