C21H27F4N5O4 — CID 68974769
N-[[3-[4-[(3S)-4-(1-acetamido-2,2,2-trifluoroethyl)-3-fluoro-3-methylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 68974769) has the molecular formula C21H27F4N5O4 and a molecular weight of 489.47 g/mol. Its IUPAC name is N-[[3-[4-[(3S)-4-(1-acetamido-2,2,2-trifluoroethyl)-3-fluoro-3-methylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(3S)-4-(1-acetamido-2,2,2-trifluoroethyl)-3-fluoro-3-methylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 68974769 |
| Molecular Formula | C21H27F4N5O4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-[[3-[4-[(3S)-4-(1-acetamido-2,2,2-trifluoroethyl)-3-fluoro-3-methylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(NC(C)=O)C(F)(F)F)[C@@](C)(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H27F4N5O4/c1-13(31)26-10-17-11-29(19(33)34-17)16-6-4-15(5-7-16)28-8-9-30(20(3,22)12-28)18(21(23,24)25)27-14(2)32/h4-7,17-18H,8-12H2,1-3H3,(H,26,31)(H,27,32)/t17?,18?,20-/m1/s1 |
| InChIKey | HIASMRPLDQJIBL-AFMYVXGZSA-N |
| XLogP | 1.98 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|