C21H24Br3F4N5O4 — CID 87640738
N-[1-[(2S)-4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoro-2-methylpiperazin-1-yl]-2,2,2-tribromoethyl]-2,2,2-trifluoroacetamide (PubChem CID 87640738) has the molecular formula C21H24Br3F4N5O4 and a molecular weight of 726.16 g/mol. Its IUPAC name is N-[1-[(2S)-4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoro-2-methylpiperazin-1-yl]-2,2,2-tribromoethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[(2S)-4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoro-2-methylpiperazin-1-yl]-2,2,2-tribromoethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87640738 |
| Molecular Formula | C21H24Br3F4N5O4 |
| Molecular Weight | 726.16 g/mol |
| Exact Mass | 722.93 |
| IUPAC Name | N-[1-[(2S)-4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoro-2-methylpiperazin-1-yl]-2,2,2-tribromoethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(NC(=O)C(F)(F)F)C(Br)(Br)Br)[C@@](C)(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H24Br3F4N5O4/c1-12(34)29-9-15-10-32(18(36)37-15)14-5-3-13(4-6-14)31-7-8-33(19(2,25)11-31)16(20(22,23)24)30-17(35)21(26,27)28/h3-6,15-16H,7-11H2,1-2H3,(H,29,34)(H,30,35)/t15?,16?,19-/m1/s1 |
| InChIKey | YPKPEDOCBUYKSG-LADRWXRNSA-N |
| XLogP | 3.80 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|