C25H24Br3Cl2F2N5O4 — CID 87640825
N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]-2,4-dichloro-5-fluorobenzamide (PubChem CID 87640825) has the molecular formula C25H24Br3Cl2F2N5O4 and a molecular weight of 807.11 g/mol. Its IUPAC name is N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 87640825 |
| Molecular Formula | C25H24Br3Cl2F2N5O4 |
| Molecular Weight | 807.11 g/mol |
| Exact Mass | 802.87 |
| IUPAC Name | N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]-2,4-dichloro-5-fluorobenzamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(NC(=O)c4cc(F)c(Cl)cc4Cl)C(Br)(Br)Br)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C25H24Br3Cl2F2N5O4/c1-13(38)33-10-16-11-37(24(40)41-16)15-4-2-14(3-5-15)35-6-7-36(21(32)12-35)23(25(26,27)28)34-22(39)17-8-20(31)19(30)9-18(17)29/h2-5,8-9,16,21,23H,6-7,10-12H2,1H3,(H,33,38)(H,34,39) |
| InChIKey | OSKYIMZXVJQLNS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.11 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|