C20H22Cl3F4N5O4 — CID 87640972
N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-trichloroethyl]-2,2,2-trifluoroacetamide (PubChem CID 87640972) has the molecular formula C20H22Cl3F4N5O4 and a molecular weight of 578.78 g/mol. Its IUPAC name is N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-trichloroethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-trichloroethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87640972 |
| Molecular Formula | C20H22Cl3F4N5O4 |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | N-[1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-trichloroethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(NC(=O)C(F)(F)F)C(Cl)(Cl)Cl)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C20H22Cl3F4N5O4/c1-11(33)28-8-14-9-32(18(35)36-14)13-4-2-12(3-5-13)30-6-7-31(15(24)10-30)16(19(21,22)23)29-17(34)20(25,26)27/h2-5,14-16H,6-10H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | KOKBIJBQNXQSJU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|