C24H27Br3FN5O3 — CID 69351174
N-[[3-[4-[4-(1-anilino-2,2,2-tribromoethyl)-3-fluoropiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 69351174) has the molecular formula C24H27Br3FN5O3 and a molecular weight of 692.22 g/mol. Its IUPAC name is N-[[3-[4-[4-(1-anilino-2,2,2-tribromoethyl)-3-fluoropiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-(1-anilino-2,2,2-tribromoethyl)-3-fluoropiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 69351174 |
| Molecular Formula | C24H27Br3FN5O3 |
| Molecular Weight | 692.22 g/mol |
| Exact Mass | 688.96 |
| IUPAC Name | N-[[3-[4-[4-(1-anilino-2,2,2-tribromoethyl)-3-fluoropiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(Nc4ccccc4)C(Br)(Br)Br)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C24H27Br3FN5O3/c1-16(34)29-13-20-14-33(23(35)36-20)19-9-7-18(8-10-19)31-11-12-32(21(28)15-31)22(24(25,26)27)30-17-5-3-2-4-6-17/h2-10,20-22,30H,11-15H2,1H3,(H,29,34) |
| InChIKey | JSYDDZSFYGXTEF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|