C19H20Cl3F4N5O4 — CID 87641261
2,2,2-trifluoro-N-[[3-[4-[(3S)-3-fluoro-4-(2,2,2-trichloro-1-formamidoethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 87641261) has the molecular formula C19H20Cl3F4N5O4 and a molecular weight of 564.75 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[3-[4-[(3S)-3-fluoro-4-(2,2,2-trichloro-1-formamidoethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[3-[4-[(3S)-3-fluoro-4-(2,2,2-trichloro-1-formamidoethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 87641261 |
| Molecular Formula | C19H20Cl3F4N5O4 |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[[3-[4-[(3S)-3-fluoro-4-(2,2,2-trichloro-1-formamidoethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | O=CNC(N1CCN(c2ccc(N3CC(CNC(=O)C(F)(F)F)OC3=O)cc2)C[C@@H]1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H20Cl3F4N5O4/c20-18(21,22)15(28-10-32)30-6-5-29(9-14(30)23)11-1-3-12(4-2-11)31-8-13(35-17(31)34)7-27-16(33)19(24,25)26/h1-4,10,13-15H,5-9H2,(H,27,33)(H,28,32)/t13?,14-,15?/m1/s1 |
| InChIKey | MMYMQLHEQSJNAF-SHARSMKWSA-N |
| XLogP | 2.55 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|