C19H23Br3FN5O4 — CID 87793255
N-[[3-[4-[3-fluoro-4-[(1R)-2,2,2-tribromo-1-formamidoethyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 87793255) has the molecular formula C19H23Br3FN5O4 and a molecular weight of 644.13 g/mol. Its IUPAC name is N-[[3-[4-[3-fluoro-4-[(1R)-2,2,2-tribromo-1-formamidoethyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[3-fluoro-4-[(1R)-2,2,2-tribromo-1-formamidoethyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 87793255 |
| Molecular Formula | C19H23Br3FN5O4 |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 640.93 |
| IUPAC Name | N-[[3-[4-[3-fluoro-4-[(1R)-2,2,2-tribromo-1-formamidoethyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN([C@@H](NC=O)C(Br)(Br)Br)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H23Br3FN5O4/c1-12(30)24-8-15-9-28(18(31)32-15)14-4-2-13(3-5-14)26-6-7-27(16(23)10-26)17(25-11-29)19(20,21)22/h2-5,11,15-17H,6-10H2,1H3,(H,24,30)(H,25,29)/t15?,16?,17-/m1/s1 |
| InChIKey | JDWHVRLDXKOKCM-OFLPRAFFSA-N |
| XLogP | 2.48 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|