C25H27Br3FN5O4 — CID 69345785
N-[(1R)-1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]benzamide (PubChem CID 69345785) has the molecular formula C25H27Br3FN5O4 and a molecular weight of 720.23 g/mol. Its IUPAC name is N-[(1R)-1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]benzamide.
| Compound Name | N-[(1R)-1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]benzamide |
|---|---|
| PubChem CID | 69345785 |
| Molecular Formula | C25H27Br3FN5O4 |
| Molecular Weight | 720.23 g/mol |
| Exact Mass | 716.96 |
| IUPAC Name | N-[(1R)-1-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-2-fluoropiperazin-1-yl]-2,2,2-tribromoethyl]benzamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN([C@@H](NC(=O)c4ccccc4)C(Br)(Br)Br)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C25H27Br3FN5O4/c1-16(35)30-13-20-14-34(24(37)38-20)19-9-7-18(8-10-19)32-11-12-33(21(29)15-32)23(25(26,27)28)31-22(36)17-5-3-2-4-6-17/h2-10,20-21,23H,11-15H2,1H3,(H,30,35)(H,31,36)/t20?,21?,23-/m1/s1 |
| InChIKey | AONFIQXFOHJENJ-YDPRHXJPSA-N |
| XLogP | 4.16 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|