C17H10N2O6 — CID 69004702
(2E)-4,6-dihydroxy-2-[(6-nitro-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 69004702) has the molecular formula C17H10N2O6 and a molecular weight of 338.28 g/mol. Its IUPAC name is (2E)-4,6-dihydroxy-2-[(6-nitro-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-4,6-dihydroxy-2-[(6-nitro-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69004702 |
| Molecular Formula | C17H10N2O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (2E)-4,6-dihydroxy-2-[(6-nitro-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C\c2c[nH]c3cc([N+](=O)[O-])ccc23)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C17H10N2O6/c20-10-5-13(21)16-14(6-10)25-15(17(16)22)3-8-7-18-12-4-9(19(23)24)1-2-11(8)12/h1-7,18,20-21H/b15-3+ |
| InChIKey | HAHJTRWTTQUEHZ-CRKCGEKBSA-N |
| XLogP | 3.10 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|