C17H10ClNO4 — CID 69003359
(2E)-2-[(7-chloro-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one (PubChem CID 69003359) has the molecular formula C17H10ClNO4 and a molecular weight of 327.72 g/mol. Its IUPAC name is (2E)-2-[(7-chloro-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one.
| Compound Name | (2E)-2-[(7-chloro-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69003359 |
| Molecular Formula | C17H10ClNO4 |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (2E)-2-[(7-chloro-1H-indol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| SMILES | O=C1/C(=C\c2c[nH]c3c(Cl)cccc23)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C17H10ClNO4/c18-11-3-1-2-10-8(7-19-16(10)11)4-14-17(22)15-12(21)5-9(20)6-13(15)23-14/h1-7,19-21H/b14-4+ |
| InChIKey | KCCPVIGWGCOXKZ-LNKIKWGQSA-N |
| XLogP | 3.85 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|