C31H36BFN4O4 — CID 69006620
N-[1-[[(1R)-2-(2-fluorophenyl)-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]quinoxaline-2-carboxamide (PubChem CID 69006620) has the molecular formula C31H36BFN4O4 and a molecular weight of 558.46 g/mol. Its IUPAC name is N-[1-[[(1R)-2-(2-fluorophenyl)-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[1-[[(1R)-2-(2-fluorophenyl)-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 69006620 |
| Molecular Formula | C31H36BFN4O4 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | N-[1-[[(1R)-2-(2-fluorophenyl)-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]amino]-2-methyl-1-oxopropan-2-yl]quinoxaline-2-carboxamide |
| SMILES | CC(C)(NC(=O)c1cnc2ccccc2n1)C(=O)N[C@@H](Cc1ccccc1F)B1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C31H36BFN4O4/c1-29(2)19-15-24(29)31(5)25(16-19)40-32(41-31)26(14-18-10-6-7-11-20(18)33)36-28(39)30(3,4)37-27(38)23-17-34-21-12-8-9-13-22(21)35-23/h6-13,17,19,24-26H,14-16H2,1-5H3,(H,36,39)(H,37,38)/t19?,24?,25?,26-,31?/m0/s1 |
| InChIKey | CDYLXXPMLCBDEW-FEMIORTISA-N |
| XLogP | 4.27 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|