C22H20O4 — CID 69011240
4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid (PubChem CID 69011240) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid.
| Compound Name | 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid |
|---|---|
| PubChem CID | 69011240 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid |
| SMILES | C=C(C(=O)O)C(C=CC(=O)O)(C=Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H20O4/c1-17(21(25)26)22(15-13-20(23)24,16-19-10-6-3-7-11-19)14-12-18-8-4-2-5-9-18/h2-15H,1,16H2,(H,23,24)(H,25,26) |
| InChIKey | QRHOGIJWOQHMMY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|