C28H30O7 — CID 69011239
4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 69011239) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69011239 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 4-benzyl-5-methylidene-4-(2-phenylethenyl)hex-2-enedioic acid;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C(=O)O)C(C=CC(=O)O)(C=Cc1ccccc1)Cc1ccccc1.C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C22H20O4.C6H10O3/c1-17(21(25)26)22(15-13-20(23)24,16-19-10-6-3-7-11-19)14-12-18-8-4-2-5-9-18;1-5(2)6(8)9-4-3-7/h2-15H,1,16H2,(H,23,24)(H,25,26);7H,1,3-4H2,2H3 |
| InChIKey | YSFBJQUBVSQXHB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|