C20H24O7 — CID 175537717
[2-(2-hydroxyethoxy)-1-(2-methylprop-2-enoyloxy)-4-phenylbut-3-en-2-yl] 3-oxobutanoate (PubChem CID 175537717) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-(2-hydroxyethoxy)-1-(2-methylprop-2-enoyloxy)-4-phenylbut-3-en-2-yl] 3-oxobutanoate.
| Compound Name | [2-(2-hydroxyethoxy)-1-(2-methylprop-2-enoyloxy)-4-phenylbut-3-en-2-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 175537717 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [2-(2-hydroxyethoxy)-1-(2-methylprop-2-enoyloxy)-4-phenylbut-3-en-2-yl] 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OCC(C=Cc1ccccc1)(OCCO)OC(=O)CC(C)=O |
| InChI | InChI=1S/C20H24O7/c1-15(2)19(24)25-14-20(26-12-11-21,27-18(23)13-16(3)22)10-9-17-7-5-4-6-8-17/h4-10,21H,1,11-14H2,2-3H3 |
| InChIKey | PKCPIULAICSMLH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|