C24H30FN5O3S — CID 69014525
[2-[[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate (PubChem CID 69014525) has the molecular formula C24H30FN5O3S and a molecular weight of 487.60 g/mol. Its IUPAC name is [2-[[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate.
| Compound Name | [2-[[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69014525 |
| Molecular Formula | C24H30FN5O3S |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [2-[[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate |
| SMILES | O=C1N=C(N2CCCCN2)SC1=Cc1ccc(F)cc1OC(=O)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C24H30FN5O3S/c25-18-6-5-17(15-21-22(31)27-23(34-21)30-12-2-1-9-26-30)20(16-18)33-24(32)29-13-7-19(8-14-29)28-10-3-4-11-28/h5-6,15-16,19,26H,1-4,7-14H2 |
| InChIKey | HDLFQZSIXXKFFF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|