C24H33FN5O6PS — CID 89160519
[2-[(5Z)-5-[[2-[4-(diethylamino)piperidine-1-carbonyl]oxy-5-fluorophenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]diazinan-1-yl]phosphonic acid (PubChem CID 89160519) has the molecular formula C24H33FN5O6PS and a molecular weight of 569.60 g/mol. Its IUPAC name is [2-[(5Z)-5-[[2-[4-(diethylamino)piperidine-1-carbonyl]oxy-5-fluorophenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]diazinan-1-yl]phosphonic acid.
| Compound Name | [2-[(5Z)-5-[[2-[4-(diethylamino)piperidine-1-carbonyl]oxy-5-fluorophenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]diazinan-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 89160519 |
| Molecular Formula | C24H33FN5O6PS |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [2-[(5Z)-5-[[2-[4-(diethylamino)piperidine-1-carbonyl]oxy-5-fluorophenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]diazinan-1-yl]phosphonic acid |
| SMILES | CCN(CC)C1CCN(C(=O)Oc2ccc(F)cc2/C=C2\SC(N3CCCCN3P(=O)(O)O)=NC2=O)CC1 |
| InChI | InChI=1S/C24H33FN5O6PS/c1-3-27(4-2)19-9-13-28(14-10-19)24(32)36-20-8-7-18(25)15-17(20)16-21-22(31)26-23(38-21)29-11-5-6-12-30(29)37(33,34)35/h7-8,15-16,19H,3-6,9-14H2,1-2H3,(H2,33,34,35)/b21-16- |
| InChIKey | CLMAUUCEPFYOST-PGMHBOJBSA-N |
| XLogP | 3.51 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|