C19H21FN4O4S — CID 89160609
[5-fluoro-2-[(Z)-[2-(3-hydroxydiazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] pyrrolidine-1-carboxylate (PubChem CID 89160609) has the molecular formula C19H21FN4O4S and a molecular weight of 420.47 g/mol. Its IUPAC name is [5-fluoro-2-[(Z)-[2-(3-hydroxydiazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [5-fluoro-2-[(Z)-[2-(3-hydroxydiazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89160609 |
| Molecular Formula | C19H21FN4O4S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [5-fluoro-2-[(Z)-[2-(3-hydroxydiazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] pyrrolidine-1-carboxylate |
| SMILES | O=C1N=C(N2CCCC(O)N2)S/C1=C\c1ccc(F)cc1OC(=O)N1CCCC1 |
| InChI | InChI=1S/C19H21FN4O4S/c20-13-6-5-12(14(11-13)28-19(27)23-7-1-2-8-23)10-15-17(26)21-18(29-15)24-9-3-4-16(25)22-24/h5-6,10-11,16,22,25H,1-4,7-9H2/b15-10- |
| InChIKey | WTWOQNWMKNOWAV-GDNBJRDFSA-N |
| XLogP | 2.31 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|