C23H30FN5O2S2 — CID 90801923
[2-[[2-(diazinan-1-yl)-4-sulfanylidene-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (3R)-3-(diethylamino)pyrrolidine-1-carboxylate (PubChem CID 90801923) has the molecular formula C23H30FN5O2S2 and a molecular weight of 491.66 g/mol. Its IUPAC name is [2-[[2-(diazinan-1-yl)-4-sulfanylidene-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (3R)-3-(diethylamino)pyrrolidine-1-carboxylate.
| Compound Name | [2-[[2-(diazinan-1-yl)-4-sulfanylidene-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (3R)-3-(diethylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90801923 |
| Molecular Formula | C23H30FN5O2S2 |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | [2-[[2-(diazinan-1-yl)-4-sulfanylidene-1,3-thiazol-5-ylidene]methyl]-5-fluorophenyl] (3R)-3-(diethylamino)pyrrolidine-1-carboxylate |
| SMILES | CCN(CC)[C@@H]1CCN(C(=O)Oc2cc(F)ccc2C=C2SC(N3CCCCN3)=NC2=S)C1 |
| InChI | InChI=1S/C23H30FN5O2S2/c1-3-27(4-2)18-9-12-28(15-18)23(30)31-19-14-17(24)8-7-16(19)13-20-21(32)26-22(33-20)29-11-6-5-10-25-29/h7-8,13-14,18,25H,3-6,9-12,15H2,1-2H3/t18-/m1/s1 |
| InChIKey | KOERXRQTEVLRQK-GOSISDBHSA-N |
| XLogP | 4.11 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|