C16H14F2N2O3S — CID 69029119
[4-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]phenyl] carbamate (PubChem CID 69029119) has the molecular formula C16H14F2N2O3S and a molecular weight of 352.36 g/mol. Its IUPAC name is [4-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]phenyl] carbamate.
| Compound Name | [4-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]phenyl] carbamate |
|---|---|
| PubChem CID | 69029119 |
| Molecular Formula | C16H14F2N2O3S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [4-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl]phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(CC(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H14F2N2O3S/c17-15(18)24-13-7-3-11(4-8-13)20-14(21)9-10-1-5-12(6-2-10)23-16(19)22/h1-8,15H,9H2,(H2,19,22)(H,20,21) |
| InChIKey | IQCBYMKMZFETCN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |