C25H31ClN2O — CID 69038198
1-(4-chlorophenyl)-2-ethyl-N,N-dimethyl-4-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butan-1-amine (PubChem CID 69038198) has the molecular formula C25H31ClN2O and a molecular weight of 410.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-ethyl-N,N-dimethyl-4-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-2-ethyl-N,N-dimethyl-4-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 69038198 |
| Molecular Formula | C25H31ClN2O |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-(4-chlorophenyl)-2-ethyl-N,N-dimethyl-4-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butan-1-amine |
| SMILES | CCC(CCC1OCCc2c1[nH]c1ccccc21)C(c1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C25H31ClN2O/c1-4-17(25(28(2)3)18-9-12-19(26)13-10-18)11-14-23-24-21(15-16-29-23)20-7-5-6-8-22(20)27-24/h5-10,12-13,17,23,25,27H,4,11,14-16H2,1-3H3 |
| InChIKey | BHLMQTZJLVYTOW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |