C15H19NO — CID 102369202
1,7-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole (PubChem CID 102369202) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 1,7-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole.
| Compound Name | 1,7-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole |
|---|---|
| PubChem CID | 102369202 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1,7-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole |
| SMILES | CCc1ccc2c3c([nH]c2c1)C(CC)OCC3 |
| InChI | InChI=1S/C15H19NO/c1-3-10-5-6-11-12-7-8-17-14(4-2)15(12)16-13(11)9-10/h5-6,9,14,16H,3-4,7-8H2,1-2H3 |
| InChIKey | NVXIYIOVKZTXPR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |