C20H26N2O — CID 141013903
1,10-diethyl-6-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine (PubChem CID 141013903) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1,10-diethyl-6-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine.
| Compound Name | 1,10-diethyl-6-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 141013903 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1,10-diethyl-6-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizine |
| SMILES | CCC1=C2c3[nH]c4cc(CC)ccc4c3CC(OC)N2CCC1 |
| InChI | InChI=1S/C20H26N2O/c1-4-13-8-9-15-16-12-18(23-3)22-10-6-7-14(5-2)20(22)19(16)21-17(15)11-13/h8-9,11,18,21H,4-7,10,12H2,1-3H3 |
| InChIKey | HKQPHPNEEDRYJU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |