C28H33N5O4 — CID 69044146
(2S)-5-(diaminomethylideneamino)-2-[[2-oxo-6-[[2-(2-propan-2-ylphenyl)phenyl]methyl]-1H-pyridine-3-carbonyl]amino]pentanoic acid (PubChem CID 69044146) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-oxo-6-[[2-(2-propan-2-ylphenyl)phenyl]methyl]-1H-pyridine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-oxo-6-[[2-(2-propan-2-ylphenyl)phenyl]methyl]-1H-pyridine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69044146 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-oxo-6-[[2-(2-propan-2-ylphenyl)phenyl]methyl]-1H-pyridine-3-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)c1ccccc1-c1ccccc1Cc1ccc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C28H33N5O4/c1-17(2)20-9-5-6-11-22(20)21-10-4-3-8-18(21)16-19-13-14-23(25(34)32-19)26(35)33-24(27(36)37)12-7-15-31-28(29)30/h3-6,8-11,13-14,17,24H,7,12,15-16H2,1-2H3,(H,32,34)(H,33,35)(H,36,37)(H4,29,30,31)/t24-/m0/s1 |
| InChIKey | YQDJLWSBVNENHJ-DEOSSOPVSA-N |
| XLogP | 2.99 |
| TPSA | 163.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|