C23H29N7O3 — CID 91382066
(2S)-5-(diaminomethylideneamino)-2-[[4-[[methyl-(1-methylimidazol-2-yl)amino]methyl]naphthalene-1-carbonyl]amino]pentanoic acid (PubChem CID 91382066) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[4-[[methyl-(1-methylimidazol-2-yl)amino]methyl]naphthalene-1-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[4-[[methyl-(1-methylimidazol-2-yl)amino]methyl]naphthalene-1-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 91382066 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[4-[[methyl-(1-methylimidazol-2-yl)amino]methyl]naphthalene-1-carbonyl]amino]pentanoic acid |
| SMILES | CN(Cc1ccc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c2ccccc12)c1nccn1C |
| InChI | InChI=1S/C23H29N7O3/c1-29-13-12-27-23(29)30(2)14-15-9-10-18(17-7-4-3-6-16(15)17)20(31)28-19(21(32)33)8-5-11-26-22(24)25/h3-4,6-7,9-10,12-13,19H,5,8,11,14H2,1-2H3,(H,28,31)(H,32,33)(H4,24,25,26)/t19-/m0/s1 |
| InChIKey | INFAIXXPYNSGDE-IBGZPJMESA-N |
| XLogP | 1.45 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|