C23H29N5 — CID 69047389
4-[3-(1-azabicyclo[2.2.2]octan-2-ylamino)propyl]-6-(3,4-dimethylphenyl)pyrimidine-2-carbonitrile (PubChem CID 69047389) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[3-(1-azabicyclo[2.2.2]octan-2-ylamino)propyl]-6-(3,4-dimethylphenyl)pyrimidine-2-carbonitrile.
| Compound Name | 4-[3-(1-azabicyclo[2.2.2]octan-2-ylamino)propyl]-6-(3,4-dimethylphenyl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69047389 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-[3-(1-azabicyclo[2.2.2]octan-2-ylamino)propyl]-6-(3,4-dimethylphenyl)pyrimidine-2-carbonitrile |
| SMILES | Cc1ccc(-c2cc(CCCNC3CC4CCN3CC4)nc(C#N)n2)cc1C |
| InChI | InChI=1S/C23H29N5/c1-16-5-6-19(12-17(16)2)21-14-20(26-22(15-24)27-21)4-3-9-25-23-13-18-7-10-28(23)11-8-18/h5-6,12,14,18,23,25H,3-4,7-11,13H2,1-2H3 |
| InChIKey | UTZYJUUCLCJPPK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|