C18H19N5O4S — CID 69139266
3-[3-[4-(benzenesulfonyl)butyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione (PubChem CID 69139266) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 3-[3-[4-(benzenesulfonyl)butyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[3-[4-(benzenesulfonyl)butyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69139266 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[3-[4-(benzenesulfonyl)butyl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
| SMILES | O=C(Cc1[nH]ccc1CCCCS(=O)(=O)c1ccccc1)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C18H19N5O4S/c24-16(17(25)18-20-22-23-21-18)12-15-13(9-10-19-15)6-4-5-11-28(26,27)14-7-2-1-3-8-14/h1-3,7-10,19H,4-6,11-12H2,(H,20,21,22,23) |
| InChIKey | ABFNWEBLOUOKEQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|