C25H30ClN3O4S — CID 69149128
oxolan-3-yl N-[3-[(3aS)-5-(3-chlorothiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate (PubChem CID 69149128) has the molecular formula C25H30ClN3O4S and a molecular weight of 504.05 g/mol. Its IUPAC name is oxolan-3-yl N-[3-[(3aS)-5-(3-chlorothiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate.
| Compound Name | oxolan-3-yl N-[3-[(3aS)-5-(3-chlorothiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 69149128 |
| Molecular Formula | C25H30ClN3O4S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | oxolan-3-yl N-[3-[(3aS)-5-(3-chlorothiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]carbamate |
| SMILES | O=C(NC(CCN1CC2CN(C(=O)c3sccc3Cl)C[C@@H]2C1)c1ccccc1)OC1CCOC1 |
| InChI | InChI=1S/C25H30ClN3O4S/c26-21-8-11-34-23(21)24(30)29-14-18-12-28(13-19(18)15-29)9-6-22(17-4-2-1-3-5-17)27-25(31)33-20-7-10-32-16-20/h1-5,8,11,18-20,22H,6-7,9-10,12-16H2,(H,27,31)/t18-,19?,20?,22?/m0/s1 |
| InChIKey | CRQVNKAZIZDWKD-GXYLUKSESA-N |
| XLogP | 4.05 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |