C23H21NO2 — CID 69158114
(2S,3S)-3-phenyl-3-(4-phenylindol-1-yl)propane-1,2-diol (PubChem CID 69158114) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2S,3S)-3-phenyl-3-(4-phenylindol-1-yl)propane-1,2-diol.
| Compound Name | (2S,3S)-3-phenyl-3-(4-phenylindol-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 69158114 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S,3S)-3-phenyl-3-(4-phenylindol-1-yl)propane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](c1ccccc1)n1ccc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C23H21NO2/c25-16-22(26)23(18-10-5-2-6-11-18)24-15-14-20-19(12-7-13-21(20)24)17-8-3-1-4-9-17/h1-15,22-23,25-26H,16H2/t22-,23+/m1/s1 |
| InChIKey | NNVMRLIMIQRLHY-PKTZIBPZSA-N |
| XLogP | 4.25 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |