C20H17BrCl2O — CID 69164026
7-bromo-2-(2,4-dichlorophenyl)spiro[chromene-4,1'-cyclohexane] (PubChem CID 69164026) has the molecular formula C20H17BrCl2O and a molecular weight of 424.17 g/mol. Its IUPAC name is 7-bromo-2-(2,4-dichlorophenyl)spiro[chromene-4,1'-cyclohexane].
| Compound Name | 7-bromo-2-(2,4-dichlorophenyl)spiro[chromene-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 69164026 |
| Molecular Formula | C20H17BrCl2O |
| Molecular Weight | 424.17 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 7-bromo-2-(2,4-dichlorophenyl)spiro[chromene-4,1'-cyclohexane] |
| SMILES | Clc1ccc(C2=CC3(CCCCC3)c3ccc(Br)cc3O2)c(Cl)c1 |
| InChI | InChI=1S/C20H17BrCl2O/c21-13-4-7-16-18(10-13)24-19(12-20(16)8-2-1-3-9-20)15-6-5-14(22)11-17(15)23/h4-7,10-12H,1-3,8-9H2 |
| InChIKey | AXPBLRAEVFHGGP-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.17 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |