C21H24O13 — CID 69173947
2-[2-[1,2-dicarboxy-4-oxo-4-(3-phenylpropoxy)butan-2-yl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 69173947) has the molecular formula C21H24O13 and a molecular weight of 484.41 g/mol. Its IUPAC name is 2-[2-[1,2-dicarboxy-4-oxo-4-(3-phenylpropoxy)butan-2-yl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[1,2-dicarboxy-4-oxo-4-(3-phenylpropoxy)butan-2-yl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 69173947 |
| Molecular Formula | C21H24O13 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-[2-[1,2-dicarboxy-4-oxo-4-(3-phenylpropoxy)butan-2-yl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC(CC(=O)O)(CC(=O)OCCCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H24O13/c22-14(23)9-20(32,18(28)29)11-17(27)34-21(19(30)31,10-15(24)25)12-16(26)33-8-4-7-13-5-2-1-3-6-13/h1-3,5-6,32H,4,7-12H2,(H,22,23)(H,24,25)(H,28,29)(H,30,31) |
| InChIKey | OYSRMEPNOROXRN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 222.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|