C15H19NO5S — CID 69174990
[5-(cyclopropylsulfamoyl)-2,2-dimethyl-3H-1-benzofuran-7-yl] acetate (PubChem CID 69174990) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is [5-(cyclopropylsulfamoyl)-2,2-dimethyl-3H-1-benzofuran-7-yl] acetate.
| Compound Name | [5-(cyclopropylsulfamoyl)-2,2-dimethyl-3H-1-benzofuran-7-yl] acetate |
|---|---|
| PubChem CID | 69174990 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [5-(cyclopropylsulfamoyl)-2,2-dimethyl-3H-1-benzofuran-7-yl] acetate |
| SMILES | CC(=O)Oc1cc(S(=O)(=O)NC2CC2)cc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C15H19NO5S/c1-9(17)20-13-7-12(22(18,19)16-11-4-5-11)6-10-8-15(2,3)21-14(10)13/h6-7,11,16H,4-5,8H2,1-3H3 |
| InChIKey | SLDNGAVLYNNNNT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|