C11H17NO2S — CID 69188816
2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)acetic acid (PubChem CID 69188816) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)acetic acid.
| Compound Name | 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)acetic acid |
|---|---|
| PubChem CID | 69188816 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)acetic acid |
| SMILES | CCCCN1C(=CC(=O)O)SC(C)=C1C |
| InChI | InChI=1S/C11H17NO2S/c1-4-5-6-12-8(2)9(3)15-10(12)7-11(13)14/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | PEUUKWNORQHVQC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|