C18H26N3OS+ — CID 69322837
(2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-[4-(dimethylamino)pyridin-1-ium-1-yl]ethanone (PubChem CID 69322837) has the molecular formula C18H26N3OS+ and a molecular weight of 332.49 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-[4-(dimethylamino)pyridin-1-ium-1-yl]ethanone.
| Compound Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-[4-(dimethylamino)pyridin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 69322837 |
| Molecular Formula | C18H26N3OS+ |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-[4-(dimethylamino)pyridin-1-ium-1-yl]ethanone |
| SMILES | CCCCN1C(C)=C(C)S/C1=C\C(=O)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H26N3OS/c1-6-7-10-21-14(2)15(3)23-18(21)13-17(22)20-11-8-16(9-12-20)19(4)5/h8-9,11-13H,6-7,10H2,1-5H3/q+1/b18-13- |
| InChIKey | DIJMOLBXNIBZKP-AQTBWJFISA-N |
| XLogP | 3.62 |
| TPSA | 27.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|