C19H22FIN2O3 — CID 69206334
tert-butyl 3-(4-fluorophenyl)-4-iodo-2-(1,2-oxazol-5-yl)piperidine-1-carboxylate (PubChem CID 69206334) has the molecular formula C19H22FIN2O3 and a molecular weight of 472.30 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorophenyl)-4-iodo-2-(1,2-oxazol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorophenyl)-4-iodo-2-(1,2-oxazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69206334 |
| Molecular Formula | C19H22FIN2O3 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | tert-butyl 3-(4-fluorophenyl)-4-iodo-2-(1,2-oxazol-5-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(I)C(c2ccc(F)cc2)C1c1ccno1 |
| InChI | InChI=1S/C19H22FIN2O3/c1-19(2,3)25-18(24)23-11-9-14(21)16(12-4-6-13(20)7-5-12)17(23)15-8-10-22-26-15/h4-8,10,14,16-17H,9,11H2,1-3H3 |
| InChIKey | INQGMEBFIXEJJX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|