C35H33NO4S — CID 69213730
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]-2-tritylsulfanylpropanoic acid (PubChem CID 69213730) has the molecular formula C35H33NO4S and a molecular weight of 563.72 g/mol. Its IUPAC name is 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]-2-tritylsulfanylpropanoic acid.
| Compound Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]-2-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 69213730 |
| Molecular Formula | C35H33NO4S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]-2-tritylsulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)n1cc(CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C35H33NO4S/c1-34(2,3)40-33(39)36-24-25(29-21-13-14-22-30(29)36)23-31(32(37)38)41-35(26-15-7-4-8-16-26,27-17-9-5-10-18-27)28-19-11-6-12-20-28/h4-22,24,31H,23H2,1-3H3,(H,37,38) |
| InChIKey | XXBMUZXJMGPAAB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|