C11H22Cl2N2O — CID 69278445
(4-hexyl-2-methyl-1,3-oxazol-5-yl)methanamine;dihydrochloride (PubChem CID 69278445) has the molecular formula C11H22Cl2N2O and a molecular weight of 269.22 g/mol. Its IUPAC name is (4-hexyl-2-methyl-1,3-oxazol-5-yl)methanamine;dihydrochloride.
| Compound Name | (4-hexyl-2-methyl-1,3-oxazol-5-yl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 69278445 |
| Molecular Formula | C11H22Cl2N2O |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (4-hexyl-2-methyl-1,3-oxazol-5-yl)methanamine;dihydrochloride |
| SMILES | CCCCCCc1nc(C)oc1CN.Cl.Cl |
| InChI | InChI=1S/C11H20N2O.2ClH/c1-3-4-5-6-7-10-11(8-12)14-9(2)13-10;;/h3-8,12H2,1-2H3;2*1H |
| InChIKey | LIEVTCSGPHSLOZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|