C15H19BF3NO2 — CID 69283192
[(4R)-2,2-dimethyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxaborolan-3-yl]oxymethanamine (PubChem CID 69283192) has the molecular formula C15H19BF3NO2 and a molecular weight of 313.13 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxaborolan-3-yl]oxymethanamine.
| Compound Name | [(4R)-2,2-dimethyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxaborolan-3-yl]oxymethanamine |
|---|---|
| PubChem CID | 69283192 |
| Molecular Formula | C15H19BF3NO2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(4R)-2,2-dimethyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxaborolan-3-yl]oxymethanamine |
| SMILES | CC1(C)OC[C@@H](/C=C/c2ccc(C(F)(F)F)cc2)B1OCN |
| InChI | InChI=1S/C15H19BF3NO2/c1-14(2)16(22-10-20)13(9-21-14)8-5-11-3-6-12(7-4-11)15(17,18)19/h3-8,13H,9-10,20H2,1-2H3/b8-5+/t13-/m1/s1 |
| InChIKey | GKWWHLVKVHGWSF-OQHXTRMZSA-N |
| XLogP | 3.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|