C30H37F3O6 — CID 163579316
(2S)-3-[[(Z)-1-methoxy-2-methylbut-2-enoxy]methyl]-2-methyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 163579316) has the molecular formula C30H37F3O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is (2S)-3-[[(Z)-1-methoxy-2-methylbut-2-enoxy]methyl]-2-methyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | (2S)-3-[[(Z)-1-methoxy-2-methylbut-2-enoxy]methyl]-2-methyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 163579316 |
| Molecular Formula | C30H37F3O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | (2S)-3-[[(Z)-1-methoxy-2-methylbut-2-enoxy]methyl]-2-methyl-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | C/C=C(/C)C(OC)OCC1C(/C=C/c2ccc(C(F)(F)F)cc2)CO[C@]1(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H37F3O6/c1-8-19(2)28(37-7)38-18-24-21(12-9-20-10-13-22(14-11-20)30(31,32)33)17-39-29(24,3)23-15-25(34-4)27(36-6)26(16-23)35-5/h8-16,21,24,28H,17-18H2,1-7H3/b12-9+,19-8-/t21?,24?,28?,29-/m1/s1 |
| InChIKey | GGEASJDUDKIPJD-BMWXRZLNSA-N |
| XLogP | 6.88 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|