C15H17F3O2 — CID 69304551
ethyl 3-ethyl-2-(2,4,6-trifluorophenyl)pent-2-enoate (PubChem CID 69304551) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is ethyl 3-ethyl-2-(2,4,6-trifluorophenyl)pent-2-enoate.
| Compound Name | ethyl 3-ethyl-2-(2,4,6-trifluorophenyl)pent-2-enoate |
|---|---|
| PubChem CID | 69304551 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl 3-ethyl-2-(2,4,6-trifluorophenyl)pent-2-enoate |
| SMILES | CCOC(=O)C(=C(CC)CC)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H17F3O2/c1-4-9(5-2)13(15(19)20-6-3)14-11(17)7-10(16)8-12(14)18/h7-8H,4-6H2,1-3H3 |
| InChIKey | HHVWDCMKKONEPL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|