C18H17F3N2O2S — CID 69319111
4-[[(R)-benzylsulfinyl]methyl-(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 69319111) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[[(R)-benzylsulfinyl]methyl-(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[(R)-benzylsulfinyl]methyl-(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69319111 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-[[(R)-benzylsulfinyl]methyl-(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N(CCO)C[S@](=O)Cc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2S/c19-18(20,21)17-10-16(7-6-15(17)11-22)23(8-9-24)13-26(25)12-14-4-2-1-3-5-14/h1-7,10,24H,8-9,12-13H2/t26-/m1/s1 |
| InChIKey | WIDLHCYFUBBBDB-AREMUKBSSA-N |
| XLogP | 3.28 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |