C17H19N5O3 — CID 69343124
2-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-5-methylpyridine-3-carboxamide (PubChem CID 69343124) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-5-methylpyridine-3-carboxamide.
| Compound Name | 2-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 69343124 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-5-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(Cc2ncc(C)cc2C(N)=O)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C17H19N5O3/c1-9-4-12(17(21)24)13(22-7-9)5-10-2-3-11(16(19)20)6-14(10)25-8-15(18)23/h2-4,6-7H,5,8H2,1H3,(H2,18,23)(H3,19,20)(H2,21,24) |
| InChIKey | XMDLDGDETXSOIT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 158.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|