C30H43N3O6 — CID 69344241
(5R)-5-[[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 69344241) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is (5R)-5-[[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69344241 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (5R)-5-[[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(Cc2cccc(CCCCOCCCCCCNC[C@H](O)c3ccc(O)c(CO)c3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C30H43N3O6/c1-30(28(37)32-29(38)33-30)19-23-11-8-10-22(17-23)9-4-7-16-39-15-6-3-2-5-14-31-20-27(36)24-12-13-26(35)25(18-24)21-34/h8,10-13,17-18,27,31,34-36H,2-7,9,14-16,19-21H2,1H3,(H2,32,33,37,38)/t27-,30+/m0/s1 |
| InChIKey | REDLKDPTKBYUNS-BHBYDHKZSA-N |
| XLogP | 3.25 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|