C21H13ClIN3O — CID 69374169
4-[3-chloro-4-(furan-3-ylmethyl)anilino]-7-iodoquinoline-3-carbonitrile (PubChem CID 69374169) has the molecular formula C21H13ClIN3O and a molecular weight of 485.71 g/mol. Its IUPAC name is 4-[3-chloro-4-(furan-3-ylmethyl)anilino]-7-iodoquinoline-3-carbonitrile.
| Compound Name | 4-[3-chloro-4-(furan-3-ylmethyl)anilino]-7-iodoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69374169 |
| Molecular Formula | C21H13ClIN3O |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | 4-[3-chloro-4-(furan-3-ylmethyl)anilino]-7-iodoquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(I)ccc2c1Nc1ccc(Cc2ccoc2)c(Cl)c1 |
| InChI | InChI=1S/C21H13ClIN3O/c22-19-9-17(3-1-14(19)7-13-5-6-27-12-13)26-21-15(10-24)11-25-20-8-16(23)2-4-18(20)21/h1-6,8-9,11-12H,7H2,(H,25,26) |
| InChIKey | NFMAQDBYOGGEER-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|