C20H22N2O2S2 — CID 69385196
2-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]butylsulfanyl]benzoic acid (PubChem CID 69385196) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]butylsulfanyl]benzoic acid.
| Compound Name | 2-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]butylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 69385196 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]butylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SCCCCNCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H22N2O2S2/c23-20(24)15-7-1-3-9-17(15)25-14-6-5-12-21-13-11-19-22-16-8-2-4-10-18(16)26-19/h1-4,7-10,21H,5-6,11-14H2,(H,23,24) |
| InChIKey | LOROOCXKVXWCMI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|