C22H22ClF3N4O3 — CID 69397297
N-butyl-6-[3-[4-chloro-2-(trifluoromethyl)benzoyl]-2-oxo-1,3-diazinan-1-yl]pyridine-3-carboxamide (PubChem CID 69397297) has the molecular formula C22H22ClF3N4O3 and a molecular weight of 482.89 g/mol. Its IUPAC name is N-butyl-6-[3-[4-chloro-2-(trifluoromethyl)benzoyl]-2-oxo-1,3-diazinan-1-yl]pyridine-3-carboxamide.
| Compound Name | N-butyl-6-[3-[4-chloro-2-(trifluoromethyl)benzoyl]-2-oxo-1,3-diazinan-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69397297 |
| Molecular Formula | C22H22ClF3N4O3 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-butyl-6-[3-[4-chloro-2-(trifluoromethyl)benzoyl]-2-oxo-1,3-diazinan-1-yl]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(N2CCCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C2=O)nc1 |
| InChI | InChI=1S/C22H22ClF3N4O3/c1-2-3-9-27-19(31)14-5-8-18(28-13-14)29-10-4-11-30(21(29)33)20(32)16-7-6-15(23)12-17(16)22(24,25)26/h5-8,12-13H,2-4,9-11H2,1H3,(H,27,31) |
| InChIKey | ROEGYYKQOUXHMW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|