C22H15Cl3N2O5 — CID 69405881
3-[3,5-dichloro-4-[3-[(3-chlorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]phenyl]imidazolidine-2,4-dione (PubChem CID 69405881) has the molecular formula C22H15Cl3N2O5 and a molecular weight of 493.73 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[3-[(3-chlorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3,5-dichloro-4-[3-[(3-chlorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69405881 |
| Molecular Formula | C22H15Cl3N2O5 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 3-[3,5-dichloro-4-[3-[(3-chlorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1c1cc(Cl)c(Oc2ccc(O)c(C(O)c3cccc(Cl)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl3N2O5/c23-12-3-1-2-11(6-12)20(30)15-9-14(4-5-18(15)28)32-21-16(24)7-13(8-17(21)25)27-19(29)10-26-22(27)31/h1-9,20,28,30H,10H2,(H,26,31) |
| InChIKey | LVONJVLOVWCUIO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|