C20H25FN2O5S2 — CID 69415747
tert-butyl N-[5-acetyl-3-[3-(4-fluorophenyl)propylsulfamoyl]thiophen-2-yl]carbamate (PubChem CID 69415747) has the molecular formula C20H25FN2O5S2 and a molecular weight of 456.56 g/mol. Its IUPAC name is tert-butyl N-[5-acetyl-3-[3-(4-fluorophenyl)propylsulfamoyl]thiophen-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-acetyl-3-[3-(4-fluorophenyl)propylsulfamoyl]thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 69415747 |
| Molecular Formula | C20H25FN2O5S2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | tert-butyl N-[5-acetyl-3-[3-(4-fluorophenyl)propylsulfamoyl]thiophen-2-yl]carbamate |
| SMILES | CC(=O)c1cc(S(=O)(=O)NCCCc2ccc(F)cc2)c(NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C20H25FN2O5S2/c1-13(24)16-12-17(18(29-16)23-19(25)28-20(2,3)4)30(26,27)22-11-5-6-14-7-9-15(21)10-8-14/h7-10,12,22H,5-6,11H2,1-4H3,(H,23,25) |
| InChIKey | FHLJZKHNCTZGDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|