About 4-hydroxybenzoic acid;1H-imidazole
4-hydroxybenzoic acid;1H-imidazole (PubChem CID 69434153) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-hydroxybenzoic acid;1H-imidazole.
Molecular Properties
| Compound Name | 4-hydroxybenzoic acid;1H-imidazole |
| PubChem CID | 69434153 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 4-hydroxybenzoic acid;1H-imidazole |
| SMILES | O=C(O)c1ccc(O)cc1.c1c[nH]cn1 |
| InChI | InChI=1S/C7H6O3.C3H4N2/c8-6-3-1-5(2-4-6)7(9)10;1-2-5-3-4-1/h1-4,8H,(H,9,10);1-3H,(H,4,5) |
| InChIKey | WLHMGMARDRLVCS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxybenzoic acid;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzoic acid;1H-imidazole?
The IUPAC name of 4-hydroxybenzoic acid;1H-imidazole (CID 69434153) is 4-hydroxybenzoic acid;1H-imidazole.
What is the SMILES notation for 4-hydroxybenzoic acid;1H-imidazole?
The canonical SMILES for 4-hydroxybenzoic acid;1H-imidazole is O=C(O)c1ccc(O)cc1.c1c[nH]cn1.
What is the InChIKey of 4-hydroxybenzoic acid;1H-imidazole?
The InChIKey is WLHMGMARDRLVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C3H4N2/c8-6-3-1-5(2-4-6)7(9)10;1-2-5-3-4-1/h1-4,8H,(H,9,10);1-3H,(H,4,5).
What are the key properties of 4-hydroxybenzoic acid;1H-imidazole?
4-hydroxybenzoic acid;1H-imidazole has a molecular weight of 206.20 g/mol, XLogP of 1.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzoic acid;1H-imidazole is sourced from PubChem (CID 69434153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).